CymitQuimica logo

CAS 898789-39-4

:

cyclopropyl-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone

Description:
Cyclopropyl-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, identified by its CAS number 898789-39-4, is a synthetic organic compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring known for its strain and reactivity, contributing to the compound's potential biological activity. The presence of a phenyl ring attached to a methanone functional group indicates that it may exhibit ketone-like properties, influencing its reactivity and interactions. Additionally, the incorporation of a 4-methylpiperazine moiety suggests potential for interactions with biological targets, as piperazine derivatives are often associated with pharmacological activity. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural complexity and the potential for diverse interactions within biological systems. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups.
Formula:C16H22N2O
InChI:InChI=1/C16H22N2O/c1-17-7-9-18(10-8-17)12-13-3-2-4-15(11-13)16(19)14-5-6-14/h2-4,11,14H,5-10,12H2,1H3
SMILES:CN1CCN(CC1)Cc1cccc(c1)C(=O)C1CC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.