CymitQuimica logo

CAS 898789-40-7

:

1-Propanone, 1-(4-bromophenyl)-3-(2-methylphenyl)-

Description:
1-Propanone, 1-(4-bromophenyl)-3-(2-methylphenyl)-, also known by its CAS number 898789-40-7, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a para-bromophenyl group and a meta-methylphenyl group. The presence of the bromine atom introduces notable electrophilic properties, which can influence its reactivity and interactions in various chemical environments. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic rings, while its ketone group may engage in hydrogen bonding with polar solvents. Additionally, the molecular structure suggests potential applications in organic synthesis and materials science, particularly in the development of pharmaceuticals or agrochemicals. Its physical properties, such as boiling point and melting point, would be influenced by the molecular weight and the nature of the substituents. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C16H15BrO
InChI:InChI=1S/C16H15BrO/c1-12-4-2-3-5-13(12)8-11-16(18)14-6-9-15(17)10-7-14/h2-7,9-10H,8,11H2,1H3
InChI key:InChIKey=JCRAJSLHLNEVED-UHFFFAOYSA-N
SMILES:C(CCC1=C(C)C=CC=C1)(=O)C2=CC=C(Br)C=C2
Synonyms:
  • 1-Propanone, 1-(4-bromophenyl)-3-(2-methylphenyl)-
  • 1-(4-Bromophenyl)-3-(2-methylphenyl)-1-propanone
  • 4′-Bromo-3-(2-methylphenyl)propiophenone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.