CymitQuimica logo

CAS 898789-41-8

:

Cyclobutyl[3-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone

Description:
Cyclobutyl[3-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone, identified by its CAS number 898789-41-8, is a synthetic organic compound characterized by its complex structure that includes a cyclobutyl group, a phenyl ring, and a piperazine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the piperazine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting its hydrophobic characteristics due to the aromatic and cyclobutyl components. Its molecular structure may impart specific reactivity patterns, influencing its stability and interactions in various chemical environments. As with many compounds containing piperazine, it may exhibit pharmacological properties, warranting further investigation for potential therapeutic applications. Safety and handling precautions should be observed, as with all chemical substances, due to the potential for toxicity or reactivity.
Formula:C17H24N2O
InChI:InChI=1S/C17H24N2O/c1-18-8-10-19(11-9-18)13-14-4-2-7-16(12-14)17(20)15-5-3-6-15/h2,4,7,12,15H,3,5-6,8-11,13H2,1H3
InChI key:InChIKey=ZISQRXXBHWPEIE-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(CN2CCN(C)CC2)=CC=C1)C3CCC3
Synonyms:
  • Methanone, cyclobutyl[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-
  • Cyclobutyl[3-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
Found 1 products.