CAS 898789-42-9
:1-(3-chlorophenyl)-3-(o-tolyl)propan-1-one
Description:
1-(3-Chlorophenyl)-3-(o-tolyl)propan-1-one, identified by its CAS number 898789-42-9, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with a 3-chlorophenyl group and an o-tolyl group attached, contributing to its unique chemical properties. The presence of the chlorine atom on the phenyl ring enhances its reactivity and may influence its biological activity, making it of interest in various fields, including medicinal chemistry. The o-tolyl group, derived from toluene, introduces additional steric and electronic effects that can affect the compound's solubility and interaction with other molecules. Typically, such compounds may exhibit properties like moderate to high lipophilicity, which can impact their pharmacokinetics if studied for pharmaceutical applications. Additionally, the compound's synthesis and reactivity can be influenced by the substituents on the aromatic rings, making it a subject of interest for further research in organic synthesis and potential therapeutic uses.
Formula:C16H15ClO
InChI:InChI=1/C16H15ClO/c1-12-5-2-3-6-13(12)9-10-16(18)14-7-4-8-15(17)11-14/h2-8,11H,9-10H2,1H3
SMILES:Cc1ccccc1CCC(=O)c1cccc(c1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.