CAS 898789-46-3
:1-Propanone, 1-(3-fluorophenyl)-3-(2-methylphenyl)-
Description:
1-Propanone, 1-(3-fluorophenyl)-3-(2-methylphenyl)-, also known by its CAS number 898789-46-3, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two aromatic substituents: a 3-fluorophenyl group and a 2-methylphenyl group. The presence of the fluorine atom introduces unique electronic properties, potentially influencing the compound's reactivity and interaction with biological systems. The aromatic rings contribute to the compound's stability and may affect its solubility in various solvents. Generally, compounds of this nature are of interest in fields such as medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in organic synthesis. The specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable databases for precise applications.
Formula:C16H15FO
InChI:InChI=1S/C16H15FO/c1-12-5-2-3-6-13(12)9-10-16(18)14-7-4-8-15(17)11-14/h2-8,11H,9-10H2,1H3
InChI key:InChIKey=OCUBUGDWAQHSLG-UHFFFAOYSA-N
SMILES:C(CCC1=C(C)C=CC=C1)(=O)C2=CC(F)=CC=C2
Synonyms:- 3′-Fluoro-3-(2-methylphenyl)propiophenone
- 1-(3-Fluorophenyl)-3-(2-methylphenyl)-1-propanone
- 1-Propanone, 1-(3-fluorophenyl)-3-(2-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.