CAS 898789-47-4
:ethyl 4-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]-4-oxo-butanoate
Description:
Ethyl 4-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]-4-oxo-butanoate, identified by its CAS number 898789-47-4, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester functional group and a piperazine moiety. This compound typically exhibits properties associated with both esters and amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbonyl group. The piperazine ring contributes to its biological activity, often enhancing interactions with biological targets, making it of interest in medicinal chemistry. The compound may also display specific pharmacological properties, which can be influenced by the substituents on the aromatic ring and the piperazine nitrogen. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in various applications, including drug development and research into new therapeutic agents. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C18H26N2O3
InChI:InChI=1/C18H26N2O3/c1-3-23-18(22)8-7-17(21)16-6-4-5-15(13-16)14-20-11-9-19(2)10-12-20/h4-6,13H,3,7-12,14H2,1-2H3
SMILES:CCOC(=O)CCC(=O)c1cccc(c1)CN1CCN(C)CC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.