CAS 898789-49-6

Ethyl 3-[(4-methyl-1-piperazinyl)methyl]-δ-oxobenzenepentanoate

Description:

Ethyl 3-[(4-methyl-1-piperazinyl)methyl]-δ-oxobenzenepentanoate, identified by its CAS number 898789-49-6, is a chemical compound characterized by its complex structure, which includes an ethyl ester group, a piperazine moiety, and a ketone functional group. This compound typically exhibits properties associated with both lipophilicity and hydrophilicity due to the presence of the ethyl ester and the piperazine ring, which can influence its solubility in various solvents. The piperazine ring often contributes to biological activity, making such compounds of interest in medicinal chemistry. Additionally, the presence of the δ-oxobenzene structure suggests potential reactivity and interactions with biological targets. The compound may be synthesized through multi-step organic reactions, and its stability, reactivity, and potential applications would depend on the specific conditions under which it is handled. As with many organic compounds, safety data sheets should be consulted for handling and toxicity information.

Formula: C₁₉H₂₈N₂O₃

InChI: InChI=1S/C19H28N2O3/c1-3-24-19(23)9-5-8-18(22)17-7-4-6-16(14-17)15-21-12-10-20(2)11-13-21/h4,6-7,14H,3,5,8-13,15H2,1-2H3

InChI key: InChIKey=QPVONZWISTWWQE-UHFFFAOYSA-N

SMILES: C(C1=CC(C(CCCC(OCC)=O)=O)=CC=C1)N2CCN(C)CC2

Synonyms:

• Benzenepentanoic acid, 3-[(4-methyl-1-piperazinyl)methyl]-δ-oxo-, ethyl ester
• Ethyl 3-[(4-methyl-1-piperazinyl)methyl]-δ-oxobenzenepentanoate

Ethyl 5-[3-(4-methylpiperazinomethyl)phenyl]-5-oxovalerate

CAS: 898789-49-6

Formula: C₁₉H₂₈N₂O₃

Purity: 97.0%

Molecular weight: 332.444

Ref: 10-F205050