CAS 898789-55-4
:Ethyl 3-[(4-methyl-1-piperazinyl)methyl]-η-oxobenzeneoctanoate
Description:
Ethyl 3-[(4-methyl-1-piperazinyl)methyl]-η-oxobenzeneoctanoate, identified by its CAS number 898789-55-4, is a chemical compound that features a complex structure combining an ethyl ester with a piperazine moiety. This compound typically exhibits characteristics such as moderate solubility in organic solvents and potential bioactivity due to the presence of the piperazine ring, which is known for its pharmacological properties. The presence of the η-oxobenzene group suggests that it may participate in various chemical reactions, including nucleophilic substitutions or electrophilic additions. Additionally, the octanoate chain contributes to its lipophilicity, which can influence its interaction with biological membranes and its overall pharmacokinetic profile. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could enhance binding affinity to biological targets. As with many chemical substances, safety and handling precautions should be observed, given the potential for toxicity or reactivity.
Formula:C22H34N2O3
InChI:InChI=1S/C22H34N2O3/c1-3-27-22(26)12-7-5-4-6-11-21(25)20-10-8-9-19(17-20)18-24-15-13-23(2)14-16-24/h8-10,17H,3-7,11-16,18H2,1-2H3
InChI key:InChIKey=NIDWATZAIRDBNH-UHFFFAOYSA-N
SMILES:C(C1=CC(C(CCCCCCC(OCC)=O)=O)=CC=C1)N2CCN(C)CC2
Synonyms:- Benzeneoctanoic acid, 3-[(4-methyl-1-piperazinyl)methyl]-η-oxo-, ethyl ester
- Ethyl 3-[(4-methyl-1-piperazinyl)methyl]-η-oxobenzeneoctanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.