CAS 898789-57-6

Methanone, [3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]phenyl-

Description:

Methanone, [3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]phenyl- is an organic compound characterized by its complex structure, which includes a methanone functional group and a phenyl ring substituted with a pyrrolidine moiety. This compound features a central carbonyl group (C=O) that is integral to its classification as a ketone. The presence of the pyrrolidine ring suggests potential for biological activity, as such nitrogen-containing heterocycles are often associated with pharmacological properties. The compound's molecular structure indicates it may exhibit specific interactions due to the presence of both aromatic and aliphatic components, which can influence its solubility, reactivity, and potential applications in medicinal chemistry. Additionally, the presence of multiple functional groups may allow for further derivatization, making it a candidate for various synthetic pathways. Overall, this compound's unique features may contribute to its utility in research and development within the fields of organic and medicinal chemistry.

Formula: C₁₈H₁₇NO

InChI: InChI=1/C18H17NO/c20-18(16-8-2-1-3-9-16)17-10-6-7-15(13-17)14-19-11-4-5-12-19/h1-10,13H,11-12,14H2

InChI key: InChIKey=UEMQYGXJWFTYGR-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CC=CC2)=CC=C1)C3=CC=CC=C3

Synonyms:

• [3-(2,5-Dihydro-1H-pyrrol-1-ylmethyl)phenyl](phenyl)methanone
• Methanone, [3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]phenyl-

3-(3-pyrrolinomethyl)benzophenone

CAS: 898789-57-6

Purity: 97.0%

Molecular weight: 263.34

Ref: 10-F205054