CAS 898789-62-3

1-(4-bromo-3-fluoro-phenyl)-3-(o-tolyl)propan-1-one

Description:

1-(4-bromo-3-fluoro-phenyl)-3-(o-tolyl)propan-1-one, with the CAS number 898789-62-3, is an organic compound characterized by its complex structure featuring a propanone backbone. This compound contains a phenyl ring substituted with both bromine and fluorine atoms, which contribute to its unique chemical reactivity and physical properties. The presence of the o-tolyl group adds to its aromatic character and influences its solubility and interaction with other molecules. Typically, such compounds exhibit moderate to high lipophilicity due to their aromatic nature, which can affect their biological activity and potential applications in pharmaceuticals or agrochemicals. The halogen substituents (bromine and fluorine) can enhance the compound's stability and alter its electronic properties, making it of interest in various chemical syntheses and research applications. Overall, this compound's specific characteristics, including its melting point, boiling point, and reactivity, would depend on its molecular interactions and the environment in which it is studied.

Formula: C₁₆H₁₄BrFO

InChI: InChI=1/C16H14BrFO/c1-11-4-2-3-5-12(11)7-9-16(19)13-6-8-14(17)15(18)10-13/h2-6,8,10H,7,9H2,1H3

SMILES: Cc1ccccc1CCC(=O)c1ccc(c(c1)F)Br