CAS 898789-63-4

Methanone, [3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl](4-methylphenyl)-

Description:

Methanone, [3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl](4-methylphenyl)-, also known by its CAS number 898789-63-4, is an organic compound characterized by its complex structure that includes a methanone functional group and multiple aromatic rings. This compound features a phenyl group substituted at the 3-position with a side chain containing a pyrrolidine moiety, which contributes to its potential biological activity. The presence of the 4-methylphenyl group enhances its lipophilicity, possibly affecting its solubility and interaction with biological membranes. Methanone derivatives often exhibit diverse pharmacological properties, making them of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in drug development, particularly in areas targeting neurological or psychiatric conditions, given the presence of the pyrrolidine ring. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound exemplifies the complexity and diversity of organic molecules in medicinal chemistry.

Formula: C₁₉H₁₉NO

InChI: InChI=1S/C19H19NO/c1-15-7-9-17(10-8-15)19(21)18-6-4-5-16(13-18)14-20-11-2-3-12-20/h2-10,13H,11-12,14H2,1H3

InChI key: InChIKey=SFYRFVRPZUYSGY-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CC=CC2)=CC=C1)C3=CC=C(C)C=C3

Synonyms:

• Methanone, [3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl](4-methylphenyl)-

4'-methyl-3-(3-pyrrolinomethyl) benzophenone

CAS: 898789-63-4

Purity: 97.0%

Molecular weight: 277.367

Ref: 10-F205057