CAS 898789-70-3
:1-(2-fluorophenyl)-3-(o-tolyl)propan-1-one
Description:
1-(2-Fluorophenyl)-3-(o-tolyl)propan-1-one, with the CAS number 898789-70-3, is an organic compound characterized by its ketone functional group, which is indicated by the presence of the "propan-1-one" structure. This compound features a propanone backbone substituted with a 2-fluorophenyl group and an o-tolyl group, contributing to its unique chemical properties. The presence of the fluorine atom enhances the compound's reactivity and may influence its electronic properties, making it of interest in various chemical applications, including medicinal chemistry and material science. The aromatic rings provide stability and can participate in π-π stacking interactions, which may affect the compound's solubility and interaction with biological targets. Additionally, the compound's molecular structure suggests potential for diverse synthetic pathways, allowing for modifications that could lead to derivatives with varying biological or chemical activities. Overall, this compound exemplifies the complexity and versatility of substituted ketones in organic chemistry.
Formula:C16H15FO
InChI:InChI=1/C16H15FO/c1-12-6-2-3-7-13(12)10-11-16(18)14-8-4-5-9-15(14)17/h2-9H,10-11H2,1H3
SMILES:Cc1ccccc1CCC(=O)c1ccccc1F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.