CAS 898789-73-6

1-Propanone, 3-(2-methylphenyl)-1-[2-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-(2-methylphenyl)-1-[2-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 2-methylphenyl group and a 2-(trifluoromethyl)phenyl group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and interaction with biological systems. Typically, compounds of this nature exhibit moderate volatility and may have varying solubility in organic solvents, depending on the substituents' nature. The trifluoromethyl group often imparts unique electronic properties, making such compounds of interest in medicinal chemistry and materials science. Additionally, the presence of multiple aromatic rings can contribute to the compound's stability and potential for π-π stacking interactions. Overall, this compound's unique structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals, although specific reactivity and toxicity profiles would require further investigation.

Formula: C₁₇H₁₅F₃O

InChI: InChI=1S/C17H15F3O/c1-12-6-2-3-7-13(12)10-11-16(21)14-8-4-5-9-15(14)17(18,19)20/h2-9H,10-11H2,1H3

InChI key: InChIKey=BJWPKSZMNLERBU-UHFFFAOYSA-N

SMILES: C(CCC1=C(C)C=CC=C1)(=O)C2=C(C(F)(F)F)C=CC=C2

Synonyms:

• 3-(2-Methylphenyl)-1-[2-(trifluoromethyl)phenyl]-1-propanone
• 1-Propanone, 3-(2-methylphenyl)-1-[2-(trifluoromethyl)phenyl]-

3-(2-methylphenyl)-2′-trifluoromethylpropiophenone

CAS: 898789-73-6

Formula: C₁₇H₁₅F₃O

Purity: 97.0%

Molecular weight: 292.301

Ref: 10-F205649