CymitQuimica logo

CAS 898789-76-9

:

3-(o-tolyl)-1-[3-(trifluoromethyl)phenyl]propan-1-one

Description:
3-(o-Tolyl)-1-[3-(trifluoromethyl)phenyl]propan-1-one, identified by its CAS number 898789-76-9, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with a tolyl group (derived from toluene) attached to one end and a trifluoromethylphenyl group on the other. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its reactivity and biological activity. The compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the electron-withdrawing nature of the trifluoromethyl group. It may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its unique structural features. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.
Formula:C17H15F3O
InChI:InChI=1/C17H15F3O/c1-12-5-2-3-6-13(12)9-10-16(21)14-7-4-8-15(11-14)17(18,19)20/h2-8,11H,9-10H2,1H3
SMILES:Cc1ccccc1CCC(=O)c1cccc(c1)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.