CAS 898789-79-2

1-Propanone, 3-(2-methylphenyl)-1-[4-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-(2-methylphenyl)-1-[4-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 2-methylphenyl group and a 4-trifluoromethylphenyl group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and may influence its reactivity and interactions in various chemical environments. The molecular structure suggests potential applications in organic synthesis and materials science, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the presence of fluorine atoms can impart unique electronic properties, making this compound of interest in medicinal chemistry. As with many organic compounds, safety considerations regarding handling and storage are essential, given the potential for toxicity or environmental impact. Overall, this compound exemplifies the complexity and diversity of organic molecules, showcasing the interplay between functional groups and molecular structure.

Formula: C₁₇H₁₅F₃O

InChI: InChI=1S/C17H15F3O/c1-12-4-2-3-5-13(12)8-11-16(21)14-6-9-15(10-7-14)17(18,19)20/h2-7,9-10H,8,11H2,1H3

InChI key: InChIKey=GPZPGQAGNLIGBX-UHFFFAOYSA-N

SMILES: C(CCC1=C(C)C=CC=C1)(=O)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• 3-(2-Methylphenyl)-4′-trifluoromethylpropiophenone
• 1-Propanone, 3-(2-methylphenyl)-1-[4-(trifluoromethyl)phenyl]-