CAS 898789-81-6

ethyl 2-[3-(2,5-dihydropyrrol-1-ylmethyl)benzoyl]benzoate

Description:

Ethyl 2-[3-(2,5-dihydropyrrol-1-ylmethyl)benzoyl]benzoate, identified by its CAS number 898789-81-6, is a chemical compound that features a complex structure combining an ethyl ester with a benzoyl moiety and a dihydropyrrole derivative. This compound typically exhibits characteristics associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility properties. The presence of the dihydropyrrole ring suggests it may participate in various chemical reactions, including those typical of nitrogen-containing heterocycles. Ethyl esters are generally known for their pleasant odors and are often used in flavor and fragrance applications. Additionally, the compound may exhibit biological activity due to its structural components, making it of interest in medicinal chemistry. Its solubility profile would likely depend on the solvent polarity, influenced by the aromatic and aliphatic portions of the molecule. Overall, this compound's unique structure may lend itself to various applications in organic synthesis and pharmaceutical development.

Formula: C₂₁H₂₁NO₃

InChI: InChI=1/C21H21NO3/c1-2-25-21(24)19-11-4-3-10-18(19)20(23)17-9-7-8-16(14-17)15-22-12-5-6-13-22/h3-11,14H,2,12-13,15H2,1H3

SMILES: CCOC(=O)c1ccccc1C(=O)c1cccc(c1)CN1CC=CC1

2-carboethoxy-3'-(3-pyrrolinomethyl) benzophenone

CAS: 898789-81-6

Purity: 97.0%

Molecular weight: 335.403

Ref: 10-F205064