CAS 898789-82-7

1-(4-bromo-2-fluoro-phenyl)-3-(o-tolyl)propan-1-one

Description:

1-(4-bromo-2-fluoro-phenyl)-3-(o-tolyl)propan-1-one, identified by its CAS number 898789-82-7, is an organic compound characterized by its complex structure featuring a propanone backbone. This compound contains a phenyl ring substituted with both bromine and fluorine atoms, which contribute to its unique chemical reactivity and physical properties. The presence of the o-tolyl group enhances its hydrophobic characteristics, influencing its solubility in organic solvents. The bromine and fluorine substituents can also affect the compound's electronic properties, potentially making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Its synthesis and handling require standard laboratory safety protocols due to the presence of halogenated groups, which can pose environmental and health risks. Overall, this compound represents a valuable entity in the field of organic synthesis and pharmaceutical development.

Formula: C₁₆H₁₄BrFO

InChI: InChI=1/C16H14BrFO/c1-11-4-2-3-5-12(11)6-9-16(19)14-8-7-13(17)10-15(14)18/h2-5,7-8,10H,6,9H2,1H3

SMILES: Cc1ccccc1CCC(=O)c1ccc(cc1F)Br