CymitQuimica logo

CAS 898789-85-0

:

1-(2-chloro-4-fluoro-phenyl)-3-(o-tolyl)propan-1-one

Description:
1-(2-Chloro-4-fluoro-phenyl)-3-(o-tolyl)propan-1-one, identified by its CAS number 898789-85-0, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone with a phenyl ring substituted at the para position with a chlorine and fluorine atom, as well as an ortho-substituted tolyl group. The presence of halogen atoms (chlorine and fluorine) typically influences the compound's reactivity, polarity, and potential biological activity. The molecular structure suggests that it may exhibit interesting properties, such as potential use in pharmaceuticals or agrochemicals, due to the presence of both electron-withdrawing and electron-donating groups. Additionally, the compound's physical properties, such as solubility and melting point, would be influenced by its molecular weight and the nature of its substituents. Overall, this compound represents a unique combination of functional groups that may lead to diverse applications in synthetic chemistry and medicinal chemistry.
Formula:C16H14ClFO
InChI:InChI=1/C16H14ClFO/c1-11-4-2-3-5-12(11)6-9-16(19)14-8-7-13(18)10-15(14)17/h2-5,7-8,10H,6,9H2,1H3
SMILES:Cc1ccccc1CCC(=O)c1ccc(cc1Cl)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.