CAS 898789-94-1
:Cyclopropyl[2-(methylthio)phenyl]methanone
Description:
Cyclopropyl[2-(methylthio)phenyl]methanone is an organic compound characterized by its unique structural features, which include a cyclopropyl group and a phenyl ring substituted with a methylthio group. This compound belongs to the class of ketones, indicated by the presence of the carbonyl functional group (C=O) in its structure. The cyclopropyl moiety contributes to the compound's strain and reactivity, potentially influencing its chemical behavior and interactions. The methylthio group, which consists of a sulfur atom bonded to a methyl group, can enhance the compound's lipophilicity and may participate in various chemical reactions, such as nucleophilic substitutions. Cyclopropyl[2-(methylthio)phenyl]methanone may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific applications and reactivity would depend on the context of its use, including potential roles in drug development or as a synthetic intermediate. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors and the presence of other functional groups.
Formula:C11H12OS
InChI:InChI=1S/C11H12OS/c1-13-10-5-3-2-4-9(10)11(12)8-6-7-8/h2-5,8H,6-7H2,1H3
InChI key:InChIKey=UKCFBWHXINMIEC-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(SC)C=CC=C1)C2CC2
Synonyms:- Cyclopropyl[2-(methylthio)phenyl]methanone
- Methanone, cyclopropyl[2-(methylthio)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.