CAS 898789-95-2

Methanone, (3-bromophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (3-bromophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a complex organic compound characterized by its unique structure, which includes a methanone functional group and multiple aromatic rings. The presence of a bromine atom at the 3-position of one of the phenyl rings contributes to its reactivity and potential applications in medicinal chemistry. The compound also features a pyrrolidine moiety, which is indicative of its potential biological activity, as pyrrolidine derivatives are often explored for their pharmacological properties. This compound may exhibit properties such as lipophilicity due to its aromatic components, which can influence its solubility and interaction with biological systems. Additionally, the presence of multiple functional groups suggests that it could participate in various chemical reactions, making it of interest for synthetic organic chemistry. Overall, the structural complexity and functional diversity of this compound may provide insights into its potential uses in drug development and other chemical applications.

Formula: C₁₈H₁₆BrNO

InChI: InChI=1S/C18H16BrNO/c19-17-8-4-7-16(12-17)18(21)15-6-3-5-14(11-15)13-20-9-1-2-10-20/h1-8,11-12H,9-10,13H2

InChI key: InChIKey=LPPXCFGDERAWJW-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CC=CC2)=CC=C1)C3=CC(Br)=CC=C3

Synonyms:

• (3-Bromophenyl)[3-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone
• Methanone, (3-bromophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

3-bromo-3'-(3-pyrrolinomethyl) benzophenone

CAS: 898789-95-2

Purity: 97.0%

Molecular weight: 342.236

Ref: 10-F205069