CAS 898789-97-4

(3-Chlorophenyl)cyclopropylmethanone

Description:

(3-Chlorophenyl)cyclopropylmethanone, identified by its CAS number 898789-97-4, is an organic compound characterized by the presence of a cyclopropyl group and a chlorophenyl moiety. This compound features a ketone functional group, which is indicative of its reactivity and potential applications in organic synthesis. The chlorophenyl group contributes to its electronic properties, potentially influencing its reactivity and interactions with other molecules. The cyclopropyl ring, known for its strain and unique geometry, can impart distinctive steric and electronic characteristics, making this compound of interest in medicinal chemistry and material science. Its structural features may allow for specific interactions in biological systems or facilitate the development of novel pharmaceuticals. Additionally, the presence of chlorine can enhance lipophilicity and alter the compound's solubility profile. Overall, (3-Chlorophenyl)cyclopropylmethanone represents a versatile scaffold for further chemical modifications and investigations in various fields of research.

Formula: C₁₀H₉ClO

InChI: InChI=1/C10H9ClO/c11-9-3-1-2-8(6-9)10(12)7-4-5-7/h1-3,6-7H,4-5H2

InChI key: InChIKey=KAZICJBPLGSMDC-UHFFFAOYSA-N

SMILES: C(=O)(C1CC1)C2=CC(Cl)=CC=C2

Synonyms:

• (3-Chlorophenyl)cyclopropylmethanone
• 3-Chlorophenyl cyclopropyl ketone
• Methanone, (3-Chlorophenyl)Cyclopropyl-
• (3-Chlorophenyl)(cyclopropyl)methanone