CAS 898790-01-7

Methanone, (3-chlorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (3-chlorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a complex organic compound characterized by its unique molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chlorophenyl group indicates that it has a chlorine substituent on one of its phenyl rings, which can influence its reactivity and physical properties. The compound also features a pyrrolidine moiety, suggesting potential biological activity, as pyrrolidine derivatives are often found in pharmaceuticals. This compound may exhibit properties such as moderate solubility in organic solvents and potential interactions with biological targets due to its structural features. Its molecular interactions could be influenced by the electron-withdrawing nature of the chlorine atom and the steric effects of the bulky phenyl groups. Overall, this compound's characteristics make it of interest in medicinal chemistry and material science, although specific properties such as melting point, boiling point, and solubility would require empirical measurement or detailed computational analysis for precise information.

Formula: C₁₈H₁₆ClNO

InChI: InChI=1S/C18H16ClNO/c19-17-8-4-7-16(12-17)18(21)15-6-3-5-14(11-15)13-20-9-1-2-10-20/h1-8,11-12H,9-10,13H2

InChI key: InChIKey=AMLYXFWSPUNDKP-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CC=CC2)=CC=C1)C3=CC(Cl)=CC=C3

Synonyms:

• Methanone, (3-chlorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-
• (3-Chlorophenyl)[3-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone

3-chloro-3'-(3-pyrrolinomethyl) benzophenone

CAS: 898790-01-7

Purity: 97.0%

Molecular weight: 297.78

Ref: 10-F205071