CAS 898790-04-0

Methanone, (4-chlorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (4-chlorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a 4-chlorophenyl group indicates that it has a chlorine substituent on the phenyl ring, which can influence its reactivity and solubility. The compound also features a pyrrolidine moiety, suggesting potential biological activity, as pyrrolidine derivatives are often found in pharmaceuticals. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic components, which can affect its absorption and distribution in biological systems. Additionally, the presence of multiple functional groups may lead to diverse chemical reactivity, making it of interest in synthetic organic chemistry and medicinal chemistry. Safety and handling considerations should be taken into account, as with many organic compounds, particularly those with halogen substituents. Overall, this compound represents a unique structure that may have applications in drug development or as a chemical intermediate.

Formula: C₁₈H₁₆ClNO

InChI: InChI=1S/C18H16ClNO/c19-17-8-6-15(7-9-17)18(21)16-5-3-4-14(12-16)13-20-10-1-2-11-20/h1-9,12H,10-11,13H2

InChI key: InChIKey=NQEVFICSQYJHGD-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CC=CC2)=CC=C1)C3=CC=C(Cl)C=C3

Synonyms:

• Methanone, (4-chlorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

4'-chloro-3-(3-pyrrolinomethyl) benzophenone

CAS: 898790-04-0

Purity: 97.0%

Molecular weight: 297.78

Ref: 10-F205072