CAS 898790-05-1
:1-(3,5-dichlorophenyl)-3-(o-tolyl)propan-1-one
Description:
1-(3,5-Dichlorophenyl)-3-(o-tolyl)propan-1-one, identified by its CAS number 898790-05-1, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with a dichlorophenyl group and an o-tolyl group attached, contributing to its unique chemical properties. The presence of the chlorine atoms on the phenyl ring enhances its reactivity and may influence its biological activity, making it of interest in various fields, including medicinal chemistry. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic rings, which can affect its solubility in organic solvents. Additionally, the structural arrangement suggests potential for various intermolecular interactions, such as hydrogen bonding and π-π stacking, which could impact its behavior in biological systems. Safety data and handling precautions should be considered, as with many organic compounds, due to potential toxicity or environmental impact. Overall, this compound's unique structure positions it as a candidate for further research in synthetic and pharmaceutical applications.
Formula:C16H14Cl2O
InChI:InChI=1/C16H14Cl2O/c1-11-4-2-3-5-12(11)6-7-16(19)13-8-14(17)10-15(18)9-13/h2-5,8-10H,6-7H2,1H3
SMILES:Cc1ccccc1CCC(=O)c1cc(cc(c1)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.