CAS 898790-09-5

Methanone, (3-chloro-4-fluorophenyl)cyclopropyl-

Description:

Methanone, (3-chloro-4-fluorophenyl)cyclopropyl- is an organic compound characterized by its unique structure, which includes a cyclopropyl group and a phenyl ring substituted with chlorine and fluorine atoms. This compound belongs to the class of ketones, specifically featuring a carbonyl group (C=O) bonded to a cyclopropyl moiety. The presence of the 3-chloro and 4-fluoro substituents on the phenyl ring can influence its reactivity and physical properties, such as solubility and boiling point. Generally, halogenated compounds like this one exhibit distinct electronic properties due to the electronegativity of chlorine and fluorine, which can affect their behavior in chemical reactions. Methanone derivatives are often studied for their potential applications in pharmaceuticals and agrochemicals, as modifications to the phenyl ring can lead to variations in biological activity. The compound's specific interactions and stability would depend on its molecular conformation and the surrounding environment.

Formula: C₁₀H₈ClFO

InChI: InChI=1S/C10H8ClFO/c11-8-5-7(3-4-9(8)12)10(13)6-1-2-6/h3-6H,1-2H2

InChI key: InChIKey=UWLYSHCUFNFEPS-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=C(F)C=C1)C2CC2

Synonyms:

• (3-Chloro-4-fluorophenyl)(cyclopropyl)methanone
• Methanone, (3-chloro-4-fluorophenyl)cyclopropyl-