CymitQuimica logo

CAS 898790-14-2

:

1-Propanone, 1-(3,5-difluorophenyl)-3-(2-methylphenyl)-

Description:
1-Propanone, 1-(3,5-difluorophenyl)-3-(2-methylphenyl)-, also known by its CAS number 898790-14-2, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 3,5-difluorophenyl group and a 2-methylphenyl group. The presence of fluorine atoms in the aromatic ring can influence the compound's reactivity and physical properties, such as polarity and boiling point. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic structures, which can affect their solubility in various solvents. Additionally, the presence of multiple functional groups may contribute to diverse chemical reactivity, making it of interest in synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks associated with exposure.
Formula:C16H14F2O
InChI:InChI=1S/C16H14F2O/c1-11-4-2-3-5-12(11)6-7-16(19)13-8-14(17)10-15(18)9-13/h2-5,8-10H,6-7H2,1H3
InChI key:InChIKey=QVYABUASVYJHLY-UHFFFAOYSA-N
SMILES:C(CCC1=C(C)C=CC=C1)(=O)C2=CC(F)=CC(F)=C2
Synonyms:
  • 1-Propanone, 1-(3,5-difluorophenyl)-3-(2-methylphenyl)-
  • 1-(3,5-Difluorophenyl)-3-(2-methylphenyl)-1-propanone
  • 3′,5′-Difluoro-3-(2-methylphenyl)propiophenone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.