CAS 898790-17-5
:3-(o-tolyl)-1-(3,4,5-trifluorophenyl)propan-1-one
Description:
3-(o-Tolyl)-1-(3,4,5-trifluorophenyl)propan-1-one, identified by its CAS number 898790-17-5, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: an o-tolyl group, which is a methyl-substituted phenyl group, and a 3,4,5-trifluorophenyl group, which contains three fluorine atoms on the phenyl ring. The presence of these fluorine atoms significantly influences the compound's electronic properties, potentially enhancing its reactivity and lipophilicity. The molecular structure suggests that it may exhibit interesting biological activities, making it a candidate for various applications in medicinal chemistry. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by the steric and electronic effects of the substituents. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly in the context of drug design and development.
Formula:C16H13F3O
InChI:InChI=1/C16H13F3O/c1-10-4-2-3-5-11(10)6-7-15(20)12-8-13(17)16(19)14(18)9-12/h2-5,8-9H,6-7H2,1H3
SMILES:Cc1ccccc1CCC(=O)c1cc(c(c(c1)F)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.