CAS 898790-19-7

Methanone, [3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl](2,5-dimethylphenyl)-

Description:

Methanone, specifically the compound with the name "3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl](2,5-dimethylphenyl)-" and CAS number 898790-19-7, is a complex organic molecule characterized by its unique structural features. It contains a methanone functional group, which is indicative of a ketone, and is further substituted with a phenyl group and a pyrrolidine moiety. The presence of the 2,5-dihydro-1H-pyrrol-1-yl group suggests potential for biological activity, as pyrrolidine derivatives are often associated with various pharmacological properties. Additionally, the 2,5-dimethylphenyl substituent contributes to the compound's hydrophobic character, influencing its solubility and interaction with biological systems. The overall structure indicates potential for diverse applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies on its physical properties, reactivity, and biological effects would be necessary to fully understand its characteristics and potential uses.

Formula: C₂₀H₂₁NO

InChI: InChI=1S/C20H21NO/c1-15-8-9-16(2)19(12-15)20(22)18-7-5-6-17(13-18)14-21-10-3-4-11-21/h3-9,12-13H,10-11,14H2,1-2H3

InChI key: InChIKey=IYMNGEIXCUOANE-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CC=CC2)=CC=C1)C3=C(C)C=CC(C)=C3

Synonyms:

• Methanone, [3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl](2,5-dimethylphenyl)-

2,5-dimethyl-3'-(3-pyrrolinomethyl) benzophenone

CAS: 898790-19-7

Purity: 97.0%

Molecular weight: 291.394

Ref: 10-F205077