CAS 898790-20-0
:1-(2,6-dichlorophenyl)-3-(o-tolyl)propan-1-one
Description:
1-(2,6-Dichlorophenyl)-3-(o-tolyl)propan-1-one, with the CAS number 898790-20-0, is an organic compound characterized by its ketone functional group, specifically a propanone structure. This compound features a dichlorophenyl group, which contributes to its potential biological activity and lipophilicity, and an o-tolyl group, indicating the presence of a methyl-substituted aromatic ring. The presence of chlorine atoms enhances the compound's reactivity and may influence its interaction with biological targets. Typically, such compounds are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The molecular structure suggests that it may exhibit interesting physical properties, such as solubility in organic solvents and varying melting and boiling points depending on the specific conditions. Additionally, the presence of multiple aromatic rings may impart stability and influence the compound's electronic properties, making it a subject of interest in medicinal chemistry and material science. Safety and handling precautions should be observed due to the potential toxicity associated with chlorinated compounds.
Formula:C16H14Cl2O
InChI:InChI=1/C16H14Cl2O/c1-11-5-2-3-6-12(11)9-10-15(19)16-13(17)7-4-8-14(16)18/h2-8H,9-10H2,1H3
SMILES:Cc1ccccc1CCC(=O)c1c(cccc1Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.