CymitQuimica logo

CAS 898790-25-5

:

1-Cyclobutyl-3-(2-methylphenyl)-1-propanone

Description:
1-Cyclobutyl-3-(2-methylphenyl)-1-propanone, identified by its CAS number 898790-25-5, is an organic compound that belongs to the class of ketones. It features a cyclobutyl group and a 2-methylphenyl substituent attached to a propanone backbone. This compound is characterized by its unique molecular structure, which contributes to its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the cyclobutyl ring can impart distinctive steric and electronic properties, influencing its reactivity and interactions with other molecules. Additionally, the aromatic 2-methylphenyl group may enhance the compound's stability and solubility in organic solvents. While specific physical properties such as boiling point, melting point, and solubility may vary, they are essential for understanding the compound's behavior in different environments. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C14H18O
InChI:InChI=1S/C14H18O/c1-11-5-2-3-6-12(11)9-10-14(15)13-7-4-8-13/h2-3,5-6,13H,4,7-10H2,1H3
InChI key:InChIKey=HOSBZLOSGGQJAT-UHFFFAOYSA-N
SMILES:C(CC(=O)C1CCC1)C2=C(C)C=CC=C2
Synonyms:
  • 1-Propanone, 1-cyclobutyl-3-(2-methylphenyl)-
  • 1-Cyclobutyl-3-(2-methylphenyl)-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.