CAS 898790-33-5

1,3-bis(m-tolyl)propan-1-one

Description:

1,3-bis(m-tolyl)propan-1-one, identified by its CAS number 898790-33-5, is an organic compound characterized by its ketone functional group and a propan-1-one backbone. This compound features two m-tolyl (3-methylphenyl) groups attached to the first and third carbon atoms of the propan-1-one structure, contributing to its unique chemical properties. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents due to its hydrophobic aromatic groups. The presence of the ketone functional group suggests that it may participate in various chemical reactions, including nucleophilic addition and condensation reactions. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its molecular structure allows for potential applications in organic synthesis and materials science. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any risks associated with its use.

Formula: C₁₇H₁₈O

InChI: InChI=1/C17H18O/c1-13-5-3-7-15(11-13)9-10-17(18)16-8-4-6-14(2)12-16/h3-8,11-12H,9-10H2,1-2H3

SMILES: Cc1cccc(CCC(=O)c2cccc(C)c2)c1