CAS 898790-34-6
:cyclopropyl-(3,5-difluorophenyl)methanone
Description:
Cyclopropyl-(3,5-difluorophenyl)methanone is an organic compound characterized by its unique structure, which includes a cyclopropyl group and a 3,5-difluorophenyl moiety attached to a carbonyl functional group (ketone). This compound typically exhibits a molecular formula that reflects its composition of carbon, hydrogen, and fluorine atoms, along with oxygen from the carbonyl group. The presence of the cyclopropyl ring contributes to its strain and reactivity, while the difluorophenyl group can influence its electronic properties and polarity due to the electronegative fluorine atoms. As a ketone, it may participate in various chemical reactions, such as nucleophilic additions or reductions. The compound's physical properties, such as boiling point, melting point, and solubility, would depend on its molecular interactions and the presence of functional groups. Cyclopropyl-(3,5-difluorophenyl)methanone may have applications in medicinal chemistry or materials science, given the significance of fluorinated compounds in enhancing biological activity and stability.
Formula:C10H8F2O
InChI:InChI=1/C10H8F2O/c11-8-3-7(4-9(12)5-8)10(13)6-1-2-6/h3-6H,1-2H2
SMILES:C1CC1C(=O)c1cc(cc(c1)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.