CymitQuimica logo

CAS 898790-36-8

:

cyclopropyl-(3,4,5-trifluorophenyl)methanone

Description:
Cyclopropyl-(3,4,5-trifluorophenyl)methanone is an organic compound characterized by its unique structural features, including a cyclopropyl group and a trifluorophenyl moiety. The presence of the cyclopropyl ring contributes to its strain and reactivity, while the trifluorophenyl group enhances its electronic properties due to the electronegative fluorine atoms, which can influence the compound's polarity and reactivity. This compound typically exhibits a solid-state at room temperature and is likely to be soluble in organic solvents due to its hydrophobic characteristics. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the trifluoromethyl groups can enhance biological activity and metabolic stability. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it of interest in synthetic organic chemistry. Safety data should be consulted for handling, as the presence of fluorine can pose specific hazards. Overall, cyclopropyl-(3,4,5-trifluorophenyl)methanone is a compound of interest due to its distinctive structural and electronic properties.
Formula:C10H7F3O
InChI:InChI=1/C10H7F3O/c11-7-3-6(4-8(12)9(7)13)10(14)5-1-2-5/h3-5H,1-2H2
SMILES:C1CC1C(=O)c1cc(c(c(c1)F)F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.