CAS 898790-37-9

1-Propanone, 1-(2-methoxyphenyl)-3-(3-methylphenyl)-

Description:

1-Propanone, 1-(2-methoxyphenyl)-3-(3-methylphenyl)-, also known by its CAS number 898790-37-9, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two aromatic substituents: a methoxyphenyl group and a methylphenyl group. The presence of these substituents contributes to its unique chemical properties, including potential reactivity and solubility characteristics. Typically, compounds of this nature exhibit moderate to high polarity due to the presence of the ketone group, which can engage in hydrogen bonding. The methoxy group enhances the electron-donating capacity of the aromatic ring, potentially influencing the compound's reactivity and interaction with other chemical species. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the overall structure of the compound. Safety data and handling precautions should be consulted due to the potential hazards associated with organic solvents and ketones.

Formula: C₁₇H₁₈O₂

InChI: InChI=1S/C17H18O2/c1-13-6-5-7-14(12-13)10-11-16(18)15-8-3-4-9-17(15)19-2/h3-9,12H,10-11H2,1-2H3

InChI key: InChIKey=LHFKDGNHUACKLM-UHFFFAOYSA-N

SMILES: C(CCC1=CC(C)=CC=C1)(=O)C2=C(OC)C=CC=C2

Synonyms:

• 1-Propanone, 1-(2-methoxyphenyl)-3-(3-methylphenyl)-
• 1-(2-Methoxyphenyl)-3-(3-methylphenyl)propan-1-one