CymitQuimica logo

CAS 898790-39-1

:

1-(3-methoxyphenyl)-3-(m-tolyl)propan-1-one

Description:
1-(3-Methoxyphenyl)-3-(m-tolyl)propan-1-one, identified by its CAS number 898790-39-1, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone substituted with a 3-methoxyphenyl group and an m-tolyl group, contributing to its unique chemical properties. It is typically characterized by its aromatic structure, which enhances its stability and reactivity. The presence of the methoxy group can influence its solubility and polarity, making it more hydrophobic. This compound may exhibit interesting biological activities, potentially making it relevant in pharmaceutical research. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, 1-(3-methoxyphenyl)-3-(m-tolyl)propan-1-one is a notable compound in organic chemistry with potential applications in various fields.
Formula:C17H18O2
InChI:InChI=1/C17H18O2/c1-13-5-3-6-14(11-13)9-10-17(18)15-7-4-8-16(12-15)19-2/h3-8,11-12H,9-10H2,1-2H3
SMILES:Cc1cccc(CCC(=O)c2cccc(c2)OC)c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.