CAS 898790-40-4
:cyclobutyl-(m-tolyl)methanone
Description:
Cyclobutyl-(m-tolyl)methanone, identified by its CAS number 898790-40-4, is an organic compound characterized by its unique structure that includes a cyclobutyl group and a m-tolyl group attached to a ketone functional group. This compound typically exhibits a solid state at room temperature and is likely to be relatively stable under standard conditions. Its molecular structure suggests it may have interesting steric and electronic properties due to the presence of the cyclobutyl ring, which can influence reactivity and interactions with other molecules. The m-tolyl group, derived from toluene, introduces a methyl substituent on the aromatic ring, potentially affecting the compound's solubility and polarity. Cyclobutyl-(m-tolyl)methanone may find applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its potential as a building block in various chemical reactions. However, specific safety and handling information should be consulted from material safety data sheets (MSDS) or relevant literature before working with this compound.
Formula:C12H14O
InChI:InChI=1/C12H14O/c1-9-4-2-7-11(8-9)12(13)10-5-3-6-10/h2,4,7-8,10H,3,5-6H2,1H3
SMILES:Cc1cccc(c1)C(=O)C1CCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.