CAS 898790-41-5
:1-(4-methoxyphenyl)-3-(m-tolyl)propan-1-one
Description:
1-(4-Methoxyphenyl)-3-(m-tolyl)propan-1-one, also known by its CAS number 898790-41-5, is an organic compound characterized by its ketone functional group. It features a propanone backbone with two aromatic substituents: a para-methoxyphenyl group and a meta-tolyl group. This compound is typically a solid at room temperature and may exhibit a white to off-white crystalline appearance. Its molecular structure suggests it may have interesting properties, including potential applications in organic synthesis and as a precursor in the development of pharmaceuticals or agrochemicals. The presence of the methoxy group can influence its solubility and reactivity, while the aromatic rings contribute to its stability and potential interactions in various chemical environments. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. However, specific safety and handling guidelines should be followed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C17H18O2
InChI:InChI=1/C17H18O2/c1-13-4-3-5-14(12-13)6-11-17(18)15-7-9-16(19-2)10-8-15/h3-5,7-10,12H,6,11H2,1-2H3
SMILES:Cc1cccc(CCC(=O)c2ccc(cc2)OC)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.