CAS 898790-42-6
:Cyclobutyl(2-methoxyphenyl)methanone
Description:
Cyclobutyl(2-methoxyphenyl)methanone, identified by its CAS number 898790-42-6, is an organic compound characterized by its unique structure, which includes a cyclobutyl group and a 2-methoxyphenyl moiety attached to a carbonyl functional group (ketone). This compound typically exhibits properties associated with both cyclic and aromatic systems, such as moderate volatility and potential solubility in organic solvents. The presence of the methoxy group enhances its electron-donating characteristics, which can influence its reactivity and interaction with other chemical species. Cyclobutyl(2-methoxyphenyl)methanone may also display interesting biological activities, making it a subject of interest in medicinal chemistry. Its synthesis often involves the reaction of appropriate precursors under controlled conditions to ensure the formation of the desired ketone. As with many organic compounds, safety precautions should be observed when handling this substance, including the use of personal protective equipment and adherence to proper storage guidelines to prevent degradation or unwanted reactions.
Formula:C12H14O2
InChI:InChI=1S/C12H14O2/c1-14-11-8-3-2-7-10(11)12(13)9-5-4-6-9/h2-3,7-9H,4-6H2,1H3
InChI key:InChIKey=VRZXSSDRRKBMRP-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC)C=CC=C1)C2CCC2
Synonyms:- Cyclobutyl(2-methoxyphenyl)methanone
- Methanone, cyclobutyl(2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.