CAS 898790-43-7
:2-[3-(m-tolyl)propanoyl]benzonitrile
Description:
2-[3-(m-Tolyl)propanoyl]benzonitrile, with the CAS number 898790-43-7, is an organic compound characterized by its complex structure, which includes a benzonitrile moiety and a propanoyl group substituted with a m-tolyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic aromatic substitution. The presence of the nitrile functional group contributes to its polarity and can influence its solubility in organic solvents. Additionally, the m-tolyl group may impart specific steric and electronic effects, affecting the compound's reactivity and interaction with biological systems. The compound's molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. Its characteristics, including melting point, boiling point, and spectral data, would be essential for practical applications and further research, but specific values would need to be referenced from experimental data or literature.
Formula:C17H15NO
InChI:InChI=1/C17H15NO/c1-13-5-4-6-14(11-13)9-10-17(19)16-8-3-2-7-15(16)12-18/h2-8,11H,9-10H2,1H3
SMILES:Cc1cccc(CCC(=O)c2ccccc2C#N)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.