CAS 898790-44-8

Cyclobutyl(3-methoxyphenyl)methanone

Description:

Cyclobutyl(3-methoxyphenyl)methanone, identified by its CAS number 898790-44-8, is an organic compound characterized by its unique structure that includes a cyclobutyl group and a methanone functional group attached to a 3-methoxyphenyl moiety. This compound typically exhibits properties associated with both cyclic and aromatic systems, such as potential stability and reactivity due to the presence of the carbonyl group. The methoxy group enhances its solubility in organic solvents and may influence its electronic properties, making it a candidate for various chemical reactions. Cyclobutyl derivatives often display interesting conformational behavior due to the strain in the four-membered ring, which can affect their reactivity and interaction with other molecules. Additionally, the presence of the aromatic ring can contribute to π-π stacking interactions, which may be relevant in biological systems or material science applications. Overall, Cyclobutyl(3-methoxyphenyl)methanone is a compound of interest in organic synthesis and medicinal chemistry, warranting further investigation into its potential applications.

Formula: C₁₂H₁₄O₂

InChI: InChI=1S/C12H14O2/c1-14-11-7-3-6-10(8-11)12(13)9-4-2-5-9/h3,6-9H,2,4-5H2,1H3

InChI key: InChIKey=POTRUZKTQWJPMV-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC)=CC=C1)C2CCC2

Synonyms:

• Cyclobutyl(3-methoxyphenyl)methanone
• Methanone, cyclobutyl(3-methoxyphenyl)-