CAS 898790-55-1

1-Propanone, 3-(3-methylphenyl)-1-[2-(methylthio)phenyl]-

Description:

1-Propanone, 3-(3-methylphenyl)-1-[2-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two aromatic substituents: a 3-methylphenyl group and a 2-(methylthio)phenyl group. The presence of the methylthio group introduces sulfur into the molecular structure, which can influence the compound's reactivity and solubility. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic content, which can affect their behavior in biological systems and their interactions with other chemical species. Additionally, the presence of multiple functional groups may lead to interesting chemical properties, such as potential for electrophilic substitution reactions or interactions with nucleophiles. Overall, this compound's unique structure suggests potential applications in fields such as pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research into its properties and behavior.

Formula: C₁₇H₁₈OS

InChI: InChI=1S/C17H18OS/c1-13-6-5-7-14(12-13)10-11-16(18)15-8-3-4-9-17(15)19-2/h3-9,12H,10-11H2,1-2H3

InChI key: InChIKey=UWQCFPQILHBLEY-UHFFFAOYSA-N

SMILES: C(CCC1=CC(C)=CC=C1)(=O)C2=C(SC)C=CC=C2

Synonyms:

• 1-Propanone, 3-(3-methylphenyl)-1-[2-(methylthio)phenyl]-

3-(3-methylphenyl)-2′-thiomethylpropiophenone

CAS: 898790-55-1

Formula: C₁₇H₁₈OS

Purity: 97.0%

Molecular weight: 270.39

Ref: 10-F205683