CAS 898790-57-3

1-Propanone, 3-(3-methylphenyl)-1-[4-(methylthio)phenyl]-

Description:

1-Propanone, 3-(3-methylphenyl)-1-[4-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two aromatic substituents: a 3-methylphenyl group and a 4-(methylthio)phenyl group. The presence of the methylthio group introduces sulfur into the molecular structure, which can influence its reactivity and physical properties. Typically, compounds of this nature exhibit moderate to high lipophilicity due to the aromatic rings, which can affect their solubility in organic solvents. The molecular structure suggests potential applications in organic synthesis, pharmaceuticals, or as intermediates in chemical reactions. Additionally, the presence of multiple functional groups may impart unique chemical reactivity, making it of interest in various chemical research fields. Safety and handling considerations should be taken into account, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₁₇H₁₈OS

InChI: InChI=1S/C17H18OS/c1-13-4-3-5-14(12-13)6-11-17(18)15-7-9-16(19-2)10-8-15/h3-5,7-10,12H,6,11H2,1-2H3

InChI key: InChIKey=WBXSSACDAXIWAR-UHFFFAOYSA-N

SMILES: C(CCC1=CC(C)=CC=C1)(=O)C2=CC=C(SC)C=C2

Synonyms:

• 1-Propanone, 3-(3-methylphenyl)-1-[4-(methylthio)phenyl]-

3-(3-methylphenyl)-4′-thiomethylpropiophenone

CAS: 898790-57-3

Formula: C₁₇H₁₈OS

Purity: 97.0%

Molecular weight: 270.39

Ref: 10-F205684