CymitQuimica logo

CAS 898790-64-2

:

cyclobutyl-(3-fluorophenyl)methanone

Description:
Cyclobutyl-(3-fluorophenyl)methanone, identified by its CAS number 898790-64-2, is an organic compound characterized by its unique structure that includes a cyclobutyl group and a 3-fluorophenyl moiety attached to a carbonyl functional group. This compound typically exhibits a solid state at room temperature and is likely to be a white to off-white crystalline substance. The presence of the fluorine atom in the phenyl ring can influence its chemical reactivity and physical properties, such as polarity and solubility. Cyclobutyl groups are known for their strain due to the four-membered ring structure, which can impart distinctive reactivity patterns. The carbonyl group (C=O) contributes to the compound's potential as a ketone, making it susceptible to nucleophilic attack. This compound may find applications in organic synthesis, medicinal chemistry, or as an intermediate in the production of more complex molecules. However, specific safety and handling information should be consulted, as with any chemical substance, to ensure proper laboratory practices.
Formula:C11H11FO
InChI:InChI=1/C11H11FO/c12-10-6-2-5-9(7-10)11(13)8-3-1-4-8/h2,5-8H,1,3-4H2
SMILES:C1CC(C1)C(=O)c1cccc(c1)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.