CAS 898790-66-4
:Cyclobutyl(2,3-dimethylphenyl)methanone
Description:
Cyclobutyl(2,3-dimethylphenyl)methanone, identified by its CAS number 898790-66-4, is an organic compound characterized by its unique structure that includes a cyclobutyl group and a 2,3-dimethylphenyl moiety attached to a ketone functional group. This compound typically exhibits properties common to ketones, such as being a liquid or solid at room temperature, depending on its specific molecular structure and intermolecular interactions. It is likely to be soluble in organic solvents due to the presence of non-polar hydrocarbon chains, while its polar carbonyl group may impart some degree of solubility in polar solvents. The presence of the cyclobutyl ring can influence its reactivity and stability, potentially making it a subject of interest in synthetic organic chemistry. Additionally, the dimethyl substitution on the phenyl ring may affect its electronic properties and steric hindrance, which can be relevant in various chemical reactions. Overall, this compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis.
Formula:C13H16O
InChI:InChI=1S/C13H16O/c1-9-5-3-8-12(10(9)2)13(14)11-6-4-7-11/h3,5,8,11H,4,6-7H2,1-2H3
InChI key:InChIKey=KZGKDKPRWOAODJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C(C)=CC=C1)C2CCC2
Synonyms:- Methanone, cyclobutyl(2,3-dimethylphenyl)-
- Cyclobutyl(2,3-dimethylphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.