CAS 898790-68-6
:cyclobutyl-(2,4-dimethylphenyl)methanone
Description:
Cyclobutyl-(2,4-dimethylphenyl)methanone is an organic compound characterized by its unique structure, which includes a cyclobutyl group and a 2,4-dimethylphenyl moiety attached to a carbonyl functional group (ketone). This compound typically exhibits a solid state at room temperature and is likely to be relatively stable under standard conditions. The presence of the cyclobutyl ring contributes to its rigidity, while the dimethylphenyl group can influence its solubility and reactivity. The compound may participate in various chemical reactions, including nucleophilic additions and substitutions, due to the electrophilic nature of the carbonyl carbon. Additionally, its molecular structure suggests potential applications in organic synthesis and materials science, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, cyclobutyl-(2,4-dimethylphenyl)methanone is a notable compound in the realm of organic chemistry with potential utility in various applications.
Formula:C13H16O
InChI:InChI=1/C13H16O/c1-9-6-7-12(10(2)8-9)13(14)11-4-3-5-11/h6-8,11H,3-5H2,1-2H3
SMILES:Cc1ccc(c(C)c1)C(=O)C1CCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.