CAS 898790-70-0

Cyclobutyl(2,5-dimethylphenyl)methanone

Description:

Cyclobutyl(2,5-dimethylphenyl)methanone, with the CAS number 898790-70-0, is an organic compound characterized by its unique structure that includes a cyclobutyl group and a 2,5-dimethylphenyl moiety attached to a carbonyl functional group (ketone). This compound typically exhibits a solid state at room temperature and is likely to be relatively stable under standard conditions. Its molecular structure suggests potential reactivity due to the presence of the carbonyl group, which can participate in various chemical reactions, such as nucleophilic additions. The cyclobutyl ring contributes to its three-dimensional conformation, potentially influencing its physical properties, such as boiling and melting points, as well as its solubility in organic solvents. Additionally, the presence of the dimethylphenyl group may enhance its hydrophobic characteristics, making it less soluble in polar solvents. Overall, this compound may find applications in organic synthesis and materials science, although specific applications would depend on further research into its reactivity and properties.

Formula: C₁₃H₁₆O

InChI: InChI=1S/C13H16O/c1-9-6-7-10(2)12(8-9)13(14)11-4-3-5-11/h6-8,11H,3-5H2,1-2H3

InChI key: InChIKey=YNFYWQWJVBKDNU-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C=CC(C)=C1)C2CCC2

Synonyms:

• Cyclobutyl(2,5-dimethylphenyl)methanone
• Methanone, cyclobutyl(2,5-dimethylphenyl)-