CAS 898790-72-2
:1-(2,4-dimethylphenyl)-3-(m-tolyl)propan-1-one
Description:
1-(2,4-Dimethylphenyl)-3-(m-tolyl)propan-1-one, also known by its CAS number 898790-72-2, is an organic compound that belongs to the class of ketones. It features a propanone backbone with two aromatic substituents: a 2,4-dimethylphenyl group and an m-tolyl group. This compound is characterized by its relatively high molecular weight and complex structure, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents, depending on the specific conditions. The presence of multiple methyl groups in the aromatic rings can influence its reactivity and stability, making it of interest in various chemical applications, including organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly.
Formula:C18H20O
InChI:InChI=1/C18H20O/c1-13-5-4-6-16(12-13)8-10-18(19)17-9-7-14(2)11-15(17)3/h4-7,9,11-12H,8,10H2,1-3H3
SMILES:Cc1cccc(CCC(=O)c2ccc(C)cc2C)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.