CAS 898790-82-4
:(4-Bromo-3-fluorophenyl)cyclobutylmethanone
Description:
(4-Bromo-3-fluorophenyl)cyclobutylmethanone is an organic compound characterized by its unique structure, which includes a cyclobutyl group attached to a ketone functional group and a phenyl ring that is substituted with both bromine and fluorine atoms. The presence of these halogens typically influences the compound's reactivity, polarity, and overall chemical behavior. The bromine and fluorine substituents can enhance the compound's lipophilicity and may also affect its biological activity, making it of interest in medicinal chemistry. The cyclobutyl moiety contributes to the compound's three-dimensional shape, potentially impacting its interactions with biological targets. This compound may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its structural features. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility would depend on the specific interactions between its molecular components. Safety and handling precautions should be observed, as with any chemical substance, particularly those containing halogens.
Formula:C11H10BrFO
InChI:InChI=1S/C11H10BrFO/c12-9-5-4-8(6-10(9)13)11(14)7-2-1-3-7/h4-7H,1-3H2
InChI key:InChIKey=FMUQYYNPJLYSLF-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=C(Br)C=C1)C2CCC2
Synonyms:- (4-Bromo-3-fluorophenyl)cyclobutylmethanone
- Methanone, (4-bromo-3-fluorophenyl)cyclobutyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.