CAS 898790-84-6
:1-Propanone, 1-(3,5-dimethylphenyl)-3-(3-methylphenyl)-
Description:
1-Propanone, 1-(3,5-dimethylphenyl)-3-(3-methylphenyl)-, also known by its CAS number 898790-84-6, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two aromatic substituents: a 3,5-dimethylphenyl group and a 3-methylphenyl group. The presence of these bulky aromatic rings contributes to its unique physical and chemical properties, including its potential solubility in organic solvents and its stability under standard conditions. The compound is likely to exhibit moderate volatility and may have a distinct odor typical of ketones. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or as an intermediate in chemical reactions. Additionally, the presence of multiple methyl groups may influence its reactivity and interaction with other chemical species. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C18H20O
InChI:InChI=1S/C18H20O/c1-13-5-4-6-16(10-13)7-8-18(19)17-11-14(2)9-15(3)12-17/h4-6,9-12H,7-8H2,1-3H3
InChI key:InChIKey=WMCYEAIJMKHYPC-UHFFFAOYSA-N
SMILES:C(CCC1=CC(C)=CC=C1)(=O)C2=CC(C)=CC(C)=C2
Synonyms:- 3′,5′-Dimethyl-3-(3-methylphenyl)propiophenone
- 1-Propanone, 1-(3,5-dimethylphenyl)-3-(3-methylphenyl)-
- 1-(3,5-Dimethylphenyl)-3-(3-methylphenyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.