CymitQuimica logo

CAS 898790-87-9

:

1-(4-bromo-3-fluoro-phenyl)-3-(m-tolyl)propan-1-one

Description:
1-(4-bromo-3-fluoro-phenyl)-3-(m-tolyl)propan-1-one, with the CAS number 898790-87-9, is an organic compound characterized by its complex structure featuring a propanone backbone. This compound contains a phenyl group substituted with both bromine and fluorine atoms, which contribute to its unique chemical properties and reactivity. The presence of the m-tolyl group enhances its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. The halogen substituents, particularly bromine and fluorine, can influence the compound's electronic properties, potentially affecting its reactivity in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Additionally, the compound may exhibit interesting biological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals, although specific biological or industrial applications would require further investigation. Overall, this compound exemplifies the diverse functionalities that can arise from halogenated aromatic systems in organic chemistry.
Formula:C16H14BrFO
InChI:InChI=1/C16H14BrFO/c1-11-3-2-4-12(9-11)5-8-16(19)13-6-7-14(17)15(18)10-13/h2-4,6-7,9-10H,5,8H2,1H3
SMILES:Cc1cccc(CCC(=O)c2ccc(c(c2)F)Br)c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.